C39H58O9 — CID 139901183
1-[1-(2,4-dimethylbenzoyl)peroxydecoxycarbonyloxy]decyl 2,4-dimethylbenzenecarboperoxoate (PubChem CID 139901183) has the molecular formula C39H58O9 and a molecular weight of 670.88 g/mol. Its IUPAC name is 1-[1-(2,4-dimethylbenzoyl)peroxydecoxycarbonyloxy]decyl 2,4-dimethylbenzenecarboperoxoate.
| Compound Name | 1-[1-(2,4-dimethylbenzoyl)peroxydecoxycarbonyloxy]decyl 2,4-dimethylbenzenecarboperoxoate |
|---|---|
| PubChem CID | 139901183 |
| Molecular Formula | C39H58O9 |
| Molecular Weight | 670.88 g/mol |
| Exact Mass | 670.41 |
| IUPAC Name | 1-[1-(2,4-dimethylbenzoyl)peroxydecoxycarbonyloxy]decyl 2,4-dimethylbenzenecarboperoxoate |
| SMILES | CCCCCCCCCC(OOC(=O)c1ccc(C)cc1C)OC(=O)OC(CCCCCCCCC)OOC(=O)c1ccc(C)cc1C |
| InChI | InChI=1S/C39H58O9/c1-7-9-11-13-15-17-19-21-35(45-47-37(40)33-25-23-29(3)27-31(33)5)43-39(42)44-36(22-20-18-16-14-12-10-8-2)46-48-38(41)34-26-24-30(4)28-32(34)6/h23-28,35-36H,7-22H2,1-6H3 |
| InChIKey | CMMMLNNSNUQUHR-UHFFFAOYSA-N |
| XLogP | 10.88 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.88 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|