C15H22O3 — CID 173265599
hexyl 2,4-dimethylbenzenecarboperoxoate (PubChem CID 173265599) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is hexyl 2,4-dimethylbenzenecarboperoxoate.
| Compound Name | hexyl 2,4-dimethylbenzenecarboperoxoate |
|---|---|
| PubChem CID | 173265599 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | hexyl 2,4-dimethylbenzenecarboperoxoate |
| SMILES | CCCCCCOOC(=O)c1ccc(C)cc1C |
| InChI | InChI=1S/C15H22O3/c1-4-5-6-7-10-17-18-15(16)14-9-8-12(2)11-13(14)3/h8-9,11H,4-7,10H2,1-3H3 |
| InChIKey | ZUESHKRKQUDXKI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|