C16H22 — CID 143183881
4-(2-cyclopropylethyl)-1-ethyl-2-prop-1-en-2-ylbenzene (PubChem CID 143183881) has the molecular formula C16H22 and a molecular weight of 214.35 g/mol. Its IUPAC name is 4-(2-cyclopropylethyl)-1-ethyl-2-prop-1-en-2-ylbenzene.
| Compound Name | 4-(2-cyclopropylethyl)-1-ethyl-2-prop-1-en-2-ylbenzene |
|---|---|
| PubChem CID | 143183881 |
| Molecular Formula | C16H22 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 4-(2-cyclopropylethyl)-1-ethyl-2-prop-1-en-2-ylbenzene |
| SMILES | C=C(C)c1cc(CCC2CC2)ccc1CC |
| InChI | InChI=1S/C16H22/c1-4-15-10-9-14(8-7-13-5-6-13)11-16(15)12(2)3/h9-11,13H,2,4-8H2,1,3H3 |
| InChIKey | DGOYXJROHDPSNY-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |