C14H19N — CID 163774691
2-[3,4-bis(prop-1-en-2-yl)phenyl]ethanamine (PubChem CID 163774691) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is 2-[3,4-bis(prop-1-en-2-yl)phenyl]ethanamine.
| Compound Name | 2-[3,4-bis(prop-1-en-2-yl)phenyl]ethanamine |
|---|---|
| PubChem CID | 163774691 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 2-[3,4-bis(prop-1-en-2-yl)phenyl]ethanamine |
| SMILES | C=C(C)c1ccc(CCN)cc1C(=C)C |
| InChI | InChI=1S/C14H19N/c1-10(2)13-6-5-12(7-8-15)9-14(13)11(3)4/h5-6,9H,1,3,7-8,15H2,2,4H3 |
| InChIKey | MJJOYKDUYRDFLT-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |