C18H26BrF — CID 22913892
4-[4-(4-bromocyclohexyl)butyl]-1-ethyl-2-fluorobenzene (PubChem CID 22913892) has the molecular formula C18H26BrF and a molecular weight of 341.31 g/mol. Its IUPAC name is 4-[4-(4-bromocyclohexyl)butyl]-1-ethyl-2-fluorobenzene.
| Compound Name | 4-[4-(4-bromocyclohexyl)butyl]-1-ethyl-2-fluorobenzene |
|---|---|
| PubChem CID | 22913892 |
| Molecular Formula | C18H26BrF |
| Molecular Weight | 341.31 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 4-[4-(4-bromocyclohexyl)butyl]-1-ethyl-2-fluorobenzene |
| SMILES | CCc1ccc(CCCCC2CCC(Br)CC2)cc1F |
| InChI | InChI=1S/C18H26BrF/c1-2-16-10-7-15(13-18(16)20)6-4-3-5-14-8-11-17(19)12-9-14/h7,10,13-14,17H,2-6,8-9,11-12H2,1H3 |
| InChIKey | CDMDUYXHXYOOHV-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.31 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|