C18H28BrFSi — CID 137327923
4-bromo-1-[4-(3-fluoro-4-propylphenyl)butyl]silinane (PubChem CID 137327923) has the molecular formula C18H28BrFSi and a molecular weight of 371.41 g/mol. Its IUPAC name is 4-bromo-1-[4-(3-fluoro-4-propylphenyl)butyl]silinane.
| Compound Name | 4-bromo-1-[4-(3-fluoro-4-propylphenyl)butyl]silinane |
|---|---|
| PubChem CID | 137327923 |
| Molecular Formula | C18H28BrFSi |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 4-bromo-1-[4-(3-fluoro-4-propylphenyl)butyl]silinane |
| SMILES | CCCc1ccc(CCCC[SiH]2CCC(Br)CC2)cc1F |
| InChI | InChI=1S/C18H28BrFSi/c1-2-5-16-8-7-15(14-18(16)20)6-3-4-11-21-12-9-17(19)10-13-21/h7-8,14,17,21H,2-6,9-13H2,1H3 |
| InChIKey | NPFHUCKSJLHHJB-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|