C12H18O2 — CID 102208154
1-(3,3-dimethoxypropyl)-2-methylbenzene (PubChem CID 102208154) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 1-(3,3-dimethoxypropyl)-2-methylbenzene.
| Compound Name | 1-(3,3-dimethoxypropyl)-2-methylbenzene |
|---|---|
| PubChem CID | 102208154 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 1-(3,3-dimethoxypropyl)-2-methylbenzene |
| SMILES | COC(CCc1ccccc1C)OC |
| InChI | InChI=1S/C12H18O2/c1-10-6-4-5-7-11(10)8-9-12(13-2)14-3/h4-7,12H,8-9H2,1-3H3 |
| InChIKey | OFGMBGZJTHNEAD-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|