About 3-(2-methylphenyl)propyl hydrogen carbonate
3-(2-methylphenyl)propyl hydrogen carbonate (PubChem CID 150352132) has the molecular formula C11H14O3
and a molecular weight of 194.23 g/mol. Its IUPAC name is 3-(2-methylphenyl)propyl hydrogen carbonate.
Molecular Properties
| Compound Name | 3-(2-methylphenyl)propyl hydrogen carbonate |
| PubChem CID | 150352132 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 3-(2-methylphenyl)propyl hydrogen carbonate |
| SMILES | Cc1ccccc1CCCOC(=O)O |
| InChI | InChI=1S/C11H14O3/c1-9-5-2-3-6-10(9)7-4-8-14-11(12)13/h2-3,5-6H,4,7-8H2,1H3,(H,12,13) |
| InChIKey | GTYMJGZJHMHYBL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-methylphenyl)propyl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methylphenyl)propyl hydrogen carbonate?
The IUPAC name of 3-(2-methylphenyl)propyl hydrogen carbonate (CID 150352132) is 3-(2-methylphenyl)propyl hydrogen carbonate.
What is the SMILES notation for 3-(2-methylphenyl)propyl hydrogen carbonate?
The canonical SMILES for 3-(2-methylphenyl)propyl hydrogen carbonate is Cc1ccccc1CCCOC(=O)O.
What is the InChIKey of 3-(2-methylphenyl)propyl hydrogen carbonate?
The InChIKey is GTYMJGZJHMHYBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3/c1-9-5-2-3-6-10(9)7-4-8-14-11(12)13/h2-3,5-6H,4,7-8H2,1H3,(H,12,13).
What are the key properties of 3-(2-methylphenyl)propyl hydrogen carbonate?
3-(2-methylphenyl)propyl hydrogen carbonate has a molecular weight of 194.23 g/mol, XLogP of 2.62, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methylphenyl)propyl hydrogen carbonate is sourced from PubChem (CID 150352132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).