3-(2-methylphenyl)propyl hydrogen carbonate

C11H14O3 — CID 150352132

IUPAC3-(2-methylphenyl)propyl hydrogen carbonate
SMILESCc1ccccc1CCCOC(=O)O
InChIInChI=1S/C11H14O3/c1-9-5-2-3-6-10(9)7-4-8-14-11(12)13/h2-3,5-6H,4,7-8H2,1H3,(H,12,13)
InChIKeyGTYMJGZJHMHYBL-UHFFFAOYSA-N
MW194.23 g/mol
LogP2.62
Rot. Bonds4

About 3-(2-methylphenyl)propyl hydrogen carbonate

3-(2-methylphenyl)propyl hydrogen carbonate (PubChem CID 150352132) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is 3-(2-methylphenyl)propyl hydrogen carbonate.

Molecular Properties

Compound Name3-(2-methylphenyl)propyl hydrogen carbonate
PubChem CID150352132
Molecular FormulaC11H14O3
Molecular Weight194.23 g/mol
Exact Mass194.09
IUPAC Name3-(2-methylphenyl)propyl hydrogen carbonate
SMILESCc1ccccc1CCCOC(=O)O
InChIInChI=1S/C11H14O3/c1-9-5-2-3-6-10(9)7-4-8-14-11(12)13/h2-3,5-6H,4,7-8H2,1H3,(H,12,13)
InChIKeyGTYMJGZJHMHYBL-UHFFFAOYSA-N
XLogP2.62
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.23
LogP ≤ 52.62
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 3-(2-methylphenyl)propyl hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2-methylphenyl)propyl hydrogen carbonate?
The IUPAC name of 3-(2-methylphenyl)propyl hydrogen carbonate (CID 150352132) is 3-(2-methylphenyl)propyl hydrogen carbonate.
What is the SMILES notation for 3-(2-methylphenyl)propyl hydrogen carbonate?
The canonical SMILES for 3-(2-methylphenyl)propyl hydrogen carbonate is Cc1ccccc1CCCOC(=O)O.
What is the InChIKey of 3-(2-methylphenyl)propyl hydrogen carbonate?
The InChIKey is GTYMJGZJHMHYBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3/c1-9-5-2-3-6-10(9)7-4-8-14-11(12)13/h2-3,5-6H,4,7-8H2,1H3,(H,12,13).
What are the key properties of 3-(2-methylphenyl)propyl hydrogen carbonate?
3-(2-methylphenyl)propyl hydrogen carbonate has a molecular weight of 194.23 g/mol, XLogP of 2.62, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methylphenyl)propyl hydrogen carbonate is sourced from PubChem (CID 150352132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).