C19H22N2O3+2 — CID 102433703
hydroxy-[4-hydroxy-3-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethyl]phenyl]-oxoazanium (PubChem CID 102433703) has the molecular formula C19H22N2O3+2 and a molecular weight of 326.40 g/mol. Its IUPAC name is hydroxy-[4-hydroxy-3-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethyl]phenyl]-oxoazanium.
| Compound Name | hydroxy-[4-hydroxy-3-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethyl]phenyl]-oxoazanium |
|---|---|
| PubChem CID | 102433703 |
| Molecular Formula | C19H22N2O3+2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | hydroxy-[4-hydroxy-3-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethyl]phenyl]-oxoazanium |
| SMILES | C[N+]1=C(CCc2cc([N+](=O)O)ccc2O)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C19H21N2O3/c1-19(2)15-6-4-5-7-16(15)20(3)18(19)11-8-13-12-14(21(23)24)9-10-17(13)22/h4-7,9-10,12H,8,11H2,1-3H3,(H-,22,23,24)/q+1/p+1 |
| InChIKey | OJESHUOKGIRGTL-UHFFFAOYSA-O |
| XLogP | 3.83 |
| TPSA | 63.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|