C31H26Br2NO+ — CID 5063011
2-[3-[4,6-bis(4-bromophenyl)pyran-2-ylidene]prop-1-enyl]-1,3,3-trimethylindol-1-ium (PubChem CID 5063011) has the molecular formula C31H26Br2NO+ and a molecular weight of 588.36 g/mol. Its IUPAC name is 2-[3-[4,6-bis(4-bromophenyl)pyran-2-ylidene]prop-1-enyl]-1,3,3-trimethylindol-1-ium.
| Compound Name | 2-[3-[4,6-bis(4-bromophenyl)pyran-2-ylidene]prop-1-enyl]-1,3,3-trimethylindol-1-ium |
|---|---|
| PubChem CID | 5063011 |
| Molecular Formula | C31H26Br2NO+ |
| Molecular Weight | 588.36 g/mol |
| Exact Mass | 586.04 |
| IUPAC Name | 2-[3-[4,6-bis(4-bromophenyl)pyran-2-ylidene]prop-1-enyl]-1,3,3-trimethylindol-1-ium |
| SMILES | C[N+]1=C(C=CC=C2C=C(c3ccc(Br)cc3)C=C(c3ccc(Br)cc3)O2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C31H26Br2NO/c1-31(2)27-8-4-5-9-28(27)34(3)30(31)10-6-7-26-19-23(21-11-15-24(32)16-12-21)20-29(35-26)22-13-17-25(33)18-14-22/h4-20H,1-3H3/q+1 |
| InChIKey | JWPZYJKJKUBVTI-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.36 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|