C36H35N2O9S3+ — CID 14454823
ethyl-[4-[[4-(N-ethyl-3-sulfoanilino)phenyl]-(2-sulfophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-[(3-sulfophenyl)methyl]azanium (PubChem CID 14454823) has the molecular formula C36H35N2O9S3+ and a molecular weight of 735.88 g/mol. Its IUPAC name is ethyl-[4-[[4-(N-ethyl-3-sulfoanilino)phenyl]-(2-sulfophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-[(3-sulfophenyl)methyl]azanium.
| Compound Name | ethyl-[4-[[4-(N-ethyl-3-sulfoanilino)phenyl]-(2-sulfophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-[(3-sulfophenyl)methyl]azanium |
|---|---|
| PubChem CID | 14454823 |
| Molecular Formula | C36H35N2O9S3+ |
| Molecular Weight | 735.88 g/mol |
| Exact Mass | 735.15 |
| IUPAC Name | ethyl-[4-[[4-(N-ethyl-3-sulfoanilino)phenyl]-(2-sulfophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-[(3-sulfophenyl)methyl]azanium |
| SMILES | CCN(c1ccc(C(=C2C=CC(=[N+](CC)Cc3cccc(S(=O)(=O)O)c3)C=C2)c2ccccc2S(=O)(=O)O)cc1)c1cccc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C36H34N2O9S3/c1-3-37(25-26-9-7-11-32(23-26)48(39,40)41)29-19-15-27(16-20-29)36(34-13-5-6-14-35(34)50(45,46)47)28-17-21-30(22-18-28)38(4-2)31-10-8-12-33(24-31)49(42,43)44/h5-24H,3-4,25H2,1-2H3,(H2-,39,40,41,42,43,44,45,46,47)/p+1 |
| InChIKey | JULBXXALJTWESP-UHFFFAOYSA-O |
| XLogP | 6.19 |
| TPSA | 169.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.88 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|