C59H81N2O5S+ — CID 157157826
butyl-[4-[[4-(N-butyl-4-decoxyanilino)phenyl]-(2-sulfophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-(4-decoxyphenyl)azanium (PubChem CID 157157826) has the molecular formula C59H81N2O5S+ and a molecular weight of 930.37 g/mol. Its IUPAC name is butyl-[4-[[4-(N-butyl-4-decoxyanilino)phenyl]-(2-sulfophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-(4-decoxyphenyl)azanium.
| Compound Name | butyl-[4-[[4-(N-butyl-4-decoxyanilino)phenyl]-(2-sulfophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-(4-decoxyphenyl)azanium |
|---|---|
| PubChem CID | 157157826 |
| Molecular Formula | C59H81N2O5S+ |
| Molecular Weight | 930.37 g/mol |
| Exact Mass | 929.59 |
| IUPAC Name | butyl-[4-[[4-(N-butyl-4-decoxyanilino)phenyl]-(2-sulfophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-(4-decoxyphenyl)azanium |
| SMILES | CCCCCCCCCCOc1ccc(N(CCCC)c2ccc(C(=C3C=CC(=[N+](CCCC)c4ccc(OCCCCCCCCCC)cc4)C=C3)c3ccccc3S(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C59H80N2O5S/c1-5-9-13-15-17-19-21-25-47-65-55-41-37-53(38-42-55)60(45-11-7-3)51-33-29-49(30-34-51)59(57-27-23-24-28-58(57)67(62,63)64)50-31-35-52(36-32-50)61(46-12-8-4)54-39-43-56(44-40-54)66-48-26-22-20-18-16-14-10-6-2/h23-24,27-44H,5-22,25-26,45-48H2,1-4H3/p+1 |
| InChIKey | AMAGMZGSKIKBGE-UHFFFAOYSA-O |
| XLogP | 16.42 |
| TPSA | 79.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 930.37 |
| LogP ≤ 5 | 16.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|