C37H36N2O3S — CID 162457938
2-[[4-[phenyl(propyl)azaniumylidene]cyclohexa-2,5-dien-1-ylidene]-[4-(N-propylanilino)phenyl]methyl]benzenesulfonate (PubChem CID 162457938) has the molecular formula C37H36N2O3S and a molecular weight of 588.77 g/mol. Its IUPAC name is 2-[[4-[phenyl(propyl)azaniumylidene]cyclohexa-2,5-dien-1-ylidene]-[4-(N-propylanilino)phenyl]methyl]benzenesulfonate.
| Compound Name | 2-[[4-[phenyl(propyl)azaniumylidene]cyclohexa-2,5-dien-1-ylidene]-[4-(N-propylanilino)phenyl]methyl]benzenesulfonate |
|---|---|
| PubChem CID | 162457938 |
| Molecular Formula | C37H36N2O3S |
| Molecular Weight | 588.77 g/mol |
| Exact Mass | 588.24 |
| IUPAC Name | 2-[[4-[phenyl(propyl)azaniumylidene]cyclohexa-2,5-dien-1-ylidene]-[4-(N-propylanilino)phenyl]methyl]benzenesulfonate |
| SMILES | CCCN(c1ccccc1)c1ccc(C(=C2C=CC(=[N+](CCC)c3ccccc3)C=C2)c2ccccc2S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C37H36N2O3S/c1-3-27-38(31-13-7-5-8-14-31)33-23-19-29(20-24-33)37(35-17-11-12-18-36(35)43(40,41)42)30-21-25-34(26-22-30)39(28-4-2)32-15-9-6-10-16-32/h5-26H,3-4,27-28H2,1-2H3 |
| InChIKey | JFIVKUYUDMASOJ-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.77 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|