C39H52N6O7S — CID 22897658
2-[[4-[bis[(butanoylamino)methyl]azaniumylidene]cyclohexa-2,5-dien-1-ylidene]-[4-[bis[4-(methylamino)-4-oxobutyl]amino]phenyl]methyl]benzenesulfonate (PubChem CID 22897658) has the molecular formula C39H52N6O7S and a molecular weight of 748.95 g/mol. Its IUPAC name is 2-[[4-[bis[(butanoylamino)methyl]azaniumylidene]cyclohexa-2,5-dien-1-ylidene]-[4-[bis[4-(methylamino)-4-oxobutyl]amino]phenyl]methyl]benzenesulfonate.
| Compound Name | 2-[[4-[bis[(butanoylamino)methyl]azaniumylidene]cyclohexa-2,5-dien-1-ylidene]-[4-[bis[4-(methylamino)-4-oxobutyl]amino]phenyl]methyl]benzenesulfonate |
|---|---|
| PubChem CID | 22897658 |
| Molecular Formula | C39H52N6O7S |
| Molecular Weight | 748.95 g/mol |
| Exact Mass | 748.36 |
| IUPAC Name | 2-[[4-[bis[(butanoylamino)methyl]azaniumylidene]cyclohexa-2,5-dien-1-ylidene]-[4-[bis[4-(methylamino)-4-oxobutyl]amino]phenyl]methyl]benzenesulfonate |
| SMILES | CCCC(=O)NC[N+](CNC(=O)CCC)=C1C=CC(=C(c2ccc(N(CCCC(=O)NC)CCCC(=O)NC)cc2)c2ccccc2S(=O)(=O)[O-])C=C1 |
| InChI | InChI=1S/C39H52N6O7S/c1-5-11-37(48)42-27-45(28-43-38(49)12-6-2)32-23-19-30(20-24-32)39(33-13-7-8-14-34(33)53(50,51)52)29-17-21-31(22-18-29)44(25-9-15-35(46)40-3)26-10-16-36(47)41-4/h7-8,13-14,17-24H,5-6,9-12,15-16,25-28H2,1-4H3,(H4-,40,41,42,43,46,47,48,49,50,51,52) |
| InChIKey | OQJSVEFUFDFCEX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 179.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.95 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|