C37H52N2O3S — CID 155613058
2-[(Z)-[4-(dibutylamino)-3-methylphenyl]-(4-dibutylazaniumylidene-3-methylcyclohexa-2,5-dien-1-ylidene)methyl]benzenesulfonate (PubChem CID 155613058) has the molecular formula C37H52N2O3S and a molecular weight of 604.90 g/mol. Its IUPAC name is 2-[(Z)-[4-(dibutylamino)-3-methylphenyl]-(4-dibutylazaniumylidene-3-methylcyclohexa-2,5-dien-1-ylidene)methyl]benzenesulfonate.
| Compound Name | 2-[(Z)-[4-(dibutylamino)-3-methylphenyl]-(4-dibutylazaniumylidene-3-methylcyclohexa-2,5-dien-1-ylidene)methyl]benzenesulfonate |
|---|---|
| PubChem CID | 155613058 |
| Molecular Formula | C37H52N2O3S |
| Molecular Weight | 604.90 g/mol |
| Exact Mass | 604.37 |
| IUPAC Name | 2-[(Z)-[4-(dibutylamino)-3-methylphenyl]-(4-dibutylazaniumylidene-3-methylcyclohexa-2,5-dien-1-ylidene)methyl]benzenesulfonate |
| SMILES | CCCCN(CCCC)c1ccc(/C(=C2\C=CC(=[N+](CCCC)CCCC)C(C)=C2)c2ccccc2S(=O)(=O)[O-])cc1C |
| InChI | InChI=1S/C37H52N2O3S/c1-7-11-23-38(24-12-8-2)34-21-19-31(27-29(34)5)37(33-17-15-16-18-36(33)43(40,41)42)32-20-22-35(30(6)28-32)39(25-13-9-3)26-14-10-4/h15-22,27-28H,7-14,23-26H2,1-6H3 |
| InChIKey | CWJRWEVJFFNINH-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.90 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|