C43H64N2O3S — CID 155613045
2-[[4-(dibutylamino)-3,5-diethylphenyl]-(4-dibutylazaniumylidene-3,5-diethylcyclohexa-2,5-dien-1-ylidene)methyl]benzenesulfonate (PubChem CID 155613045) has the molecular formula C43H64N2O3S and a molecular weight of 689.06 g/mol. Its IUPAC name is 2-[[4-(dibutylamino)-3,5-diethylphenyl]-(4-dibutylazaniumylidene-3,5-diethylcyclohexa-2,5-dien-1-ylidene)methyl]benzenesulfonate.
| Compound Name | 2-[[4-(dibutylamino)-3,5-diethylphenyl]-(4-dibutylazaniumylidene-3,5-diethylcyclohexa-2,5-dien-1-ylidene)methyl]benzenesulfonate |
|---|---|
| PubChem CID | 155613045 |
| Molecular Formula | C43H64N2O3S |
| Molecular Weight | 689.06 g/mol |
| Exact Mass | 688.46 |
| IUPAC Name | 2-[[4-(dibutylamino)-3,5-diethylphenyl]-(4-dibutylazaniumylidene-3,5-diethylcyclohexa-2,5-dien-1-ylidene)methyl]benzenesulfonate |
| SMILES | CCCCN(CCCC)c1c(CC)cc(C(=C2C=C(CC)C(=[N+](CCCC)CCCC)C(CC)=C2)c2ccccc2S(=O)(=O)[O-])cc1CC |
| InChI | InChI=1S/C43H64N2O3S/c1-9-17-25-44(26-18-10-2)42-33(13-5)29-37(30-34(42)14-6)41(39-23-21-22-24-40(39)49(46,47)48)38-31-35(15-7)43(36(16-8)32-38)45(27-19-11-3)28-20-12-4/h21-24,29-32H,9-20,25-28H2,1-8H3 |
| InChIKey | SHTZCVZCLPTRES-UHFFFAOYSA-N |
| XLogP | 10.66 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.06 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|