C40H41N2O8S2+ — CID 158841338
[4-[[4-[N-(carboxymethyl)-2,4,6-trimethylanilino]phenyl]-(2-sulfophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-methyl-(2,4,6-trimethyl-3-sulfophenyl)azanium (PubChem CID 158841338) has the molecular formula C40H41N2O8S2+ and a molecular weight of 741.91 g/mol. Its IUPAC name is [4-[[4-[N-(carboxymethyl)-2,4,6-trimethylanilino]phenyl]-(2-sulfophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-methyl-(2,4,6-trimethyl-3-sulfophenyl)azanium.
| Compound Name | [4-[[4-[N-(carboxymethyl)-2,4,6-trimethylanilino]phenyl]-(2-sulfophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-methyl-(2,4,6-trimethyl-3-sulfophenyl)azanium |
|---|---|
| PubChem CID | 158841338 |
| Molecular Formula | C40H41N2O8S2+ |
| Molecular Weight | 741.91 g/mol |
| Exact Mass | 741.23 |
| IUPAC Name | [4-[[4-[N-(carboxymethyl)-2,4,6-trimethylanilino]phenyl]-(2-sulfophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-methyl-(2,4,6-trimethyl-3-sulfophenyl)azanium |
| SMILES | Cc1cc(C)c(N(CC(=O)O)c2ccc(C(=C3C=CC(=[N+](C)c4c(C)cc(C)c(S(=O)(=O)O)c4C)C=C3)c3ccccc3S(=O)(=O)O)cc2)c(C)c1 |
| InChI | InChI=1S/C40H40N2O8S2/c1-24-20-25(2)38(26(3)21-24)42(23-36(43)44)33-18-14-31(15-19-33)37(34-10-8-9-11-35(34)51(45,46)47)30-12-16-32(17-13-30)41(7)39-27(4)22-28(5)40(29(39)6)52(48,49)50/h8-22H,23H2,1-7H3,(H2-,43,44,45,46,47,48,49,50)/p+1 |
| InChIKey | GOKSTXNINFMSDF-UHFFFAOYSA-O |
| XLogP | 7.60 |
| TPSA | 152.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.91 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|