C21H20N2O3 — CID 59687446
3-[4-(dimethylamino)phenyl]-5-(4-ethyliminocyclohexa-2,5-dien-1-ylidene)-4-hydroxycyclopent-3-ene-1,2-dione (PubChem CID 59687446) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is 3-[4-(dimethylamino)phenyl]-5-(4-ethyliminocyclohexa-2,5-dien-1-ylidene)-4-hydroxycyclopent-3-ene-1,2-dione.
| Compound Name | 3-[4-(dimethylamino)phenyl]-5-(4-ethyliminocyclohexa-2,5-dien-1-ylidene)-4-hydroxycyclopent-3-ene-1,2-dione |
|---|---|
| PubChem CID | 59687446 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 3-[4-(dimethylamino)phenyl]-5-(4-ethyliminocyclohexa-2,5-dien-1-ylidene)-4-hydroxycyclopent-3-ene-1,2-dione |
| SMILES | CCN=C1C=CC(=C2C(=O)C(=O)C(c3ccc(N(C)C)cc3)=C2O)C=C1 |
| InChI | InChI=1S/C21H20N2O3/c1-4-22-15-9-5-13(6-10-15)17-19(24)18(21(26)20(17)25)14-7-11-16(12-8-14)23(2)3/h5-12,24H,4H2,1-3H3/b17-13-,22-15- |
| InChIKey | CYMBDEQTUFYGLI-IZYALFHOSA-N |
| XLogP | 3.06 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|