C21H22N2O — CID 90716671
4-[(4-ethyliminocyclohexa-2,5-dien-1-ylidene)-(furan-2-yl)methyl]-N,N-dimethylaniline (PubChem CID 90716671) has the molecular formula C21H22N2O and a molecular weight of 318.42 g/mol. Its IUPAC name is 4-[(4-ethyliminocyclohexa-2,5-dien-1-ylidene)-(furan-2-yl)methyl]-N,N-dimethylaniline.
| Compound Name | 4-[(4-ethyliminocyclohexa-2,5-dien-1-ylidene)-(furan-2-yl)methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 90716671 |
| Molecular Formula | C21H22N2O |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 4-[(4-ethyliminocyclohexa-2,5-dien-1-ylidene)-(furan-2-yl)methyl]-N,N-dimethylaniline |
| SMILES | CCN=C1C=CC(=C(c2ccc(N(C)C)cc2)c2ccco2)C=C1 |
| InChI | InChI=1S/C21H22N2O/c1-4-22-18-11-7-16(8-12-18)21(20-6-5-15-24-20)17-9-13-19(14-10-17)23(2)3/h5-15H,4H2,1-3H3/b21-16-,22-18- |
| InChIKey | PHGPDJJPWZNNDC-LCKPMVDNSA-N |
| XLogP | 4.73 |
| TPSA | 28.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|