C22H23N3 — CID 90979931
4-[(4-ethyliminocyclohexa-2,5-dien-1-ylidene)-pyridin-3-ylmethyl]-N,N-dimethylaniline (PubChem CID 90979931) has the molecular formula C22H23N3 and a molecular weight of 329.45 g/mol. Its IUPAC name is 4-[(4-ethyliminocyclohexa-2,5-dien-1-ylidene)-pyridin-3-ylmethyl]-N,N-dimethylaniline.
| Compound Name | 4-[(4-ethyliminocyclohexa-2,5-dien-1-ylidene)-pyridin-3-ylmethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 90979931 |
| Molecular Formula | C22H23N3 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 4-[(4-ethyliminocyclohexa-2,5-dien-1-ylidene)-pyridin-3-ylmethyl]-N,N-dimethylaniline |
| SMILES | CCN=C1C=CC(=C(c2ccc(N(C)C)cc2)c2cccnc2)C=C1 |
| InChI | InChI=1S/C22H23N3/c1-4-24-20-11-7-17(8-12-20)22(19-6-5-15-23-16-19)18-9-13-21(14-10-18)25(2)3/h5-16H,4H2,1-3H3/b22-17-,24-20- |
| InChIKey | LNNRSXMBMKZGFC-SWXFWFCESA-N |
| XLogP | 4.54 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|