C10H15N3O — CID 57189340
N,N-diethyl-N'-hydroxypyridine-3-carboximidamide (PubChem CID 57189340) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is N,N-diethyl-N'-hydroxypyridine-3-carboximidamide.
| Compound Name | N,N-diethyl-N'-hydroxypyridine-3-carboximidamide |
|---|---|
| PubChem CID | 57189340 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | N,N-diethyl-N'-hydroxypyridine-3-carboximidamide |
| SMILES | CCN(CC)C(=NO)c1cccnc1 |
| InChI | InChI=1S/C10H15N3O/c1-3-13(4-2)10(12-14)9-6-5-7-11-8-9/h5-8,14H,3-4H2,1-2H3 |
| InChIKey | LBUXPSWBIPQMQF-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|