C24H26N4O4 — CID 59306542
1,4-bis[4-(dimethylamino)phenyl]-2,5-bis(hydroxymethyl)pyrrolo[3,4-c]pyrrole-3,6-dione (PubChem CID 59306542) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is 1,4-bis[4-(dimethylamino)phenyl]-2,5-bis(hydroxymethyl)pyrrolo[3,4-c]pyrrole-3,6-dione.
| Compound Name | 1,4-bis[4-(dimethylamino)phenyl]-2,5-bis(hydroxymethyl)pyrrolo[3,4-c]pyrrole-3,6-dione |
|---|---|
| PubChem CID | 59306542 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 1,4-bis[4-(dimethylamino)phenyl]-2,5-bis(hydroxymethyl)pyrrolo[3,4-c]pyrrole-3,6-dione |
| SMILES | CN(C)c1ccc(C2=C3C(=O)N(CO)C(c4ccc(N(C)C)cc4)=C3C(=O)N2CO)cc1 |
| InChI | InChI=1S/C24H26N4O4/c1-25(2)17-9-5-15(6-10-17)21-19-20(24(32)27(21)13-29)22(28(14-30)23(19)31)16-7-11-18(12-8-16)26(3)4/h5-12,29-30H,13-14H2,1-4H3 |
| InChIKey | PHDJZFRTAJQXRQ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'} |
|---|