C16H17NO2 — CID 89357003
5-[4-(dimethylamino)phenyl]-2-(hydroxymethyl)benzaldehyde (PubChem CID 89357003) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is 5-[4-(dimethylamino)phenyl]-2-(hydroxymethyl)benzaldehyde.
| Compound Name | 5-[4-(dimethylamino)phenyl]-2-(hydroxymethyl)benzaldehyde |
|---|---|
| PubChem CID | 89357003 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 5-[4-(dimethylamino)phenyl]-2-(hydroxymethyl)benzaldehyde |
| SMILES | CN(C)c1ccc(-c2ccc(CO)c(C=O)c2)cc1 |
| InChI | InChI=1S/C16H17NO2/c1-17(2)16-7-5-12(6-8-16)13-3-4-14(10-18)15(9-13)11-19/h3-9,11,18H,10H2,1-2H3 |
| InChIKey | CAHCYMBECVJHMA-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|