C30H37NO3 — CID 11525429
4-[3-[3-tert-butyl-4-(diethylamino)phenyl]-4-(3-hydroxypropyl)phenyl]benzoic acid (PubChem CID 11525429) has the molecular formula C30H37NO3 and a molecular weight of 459.63 g/mol. Its IUPAC name is 4-[3-[3-tert-butyl-4-(diethylamino)phenyl]-4-(3-hydroxypropyl)phenyl]benzoic acid.
| Compound Name | 4-[3-[3-tert-butyl-4-(diethylamino)phenyl]-4-(3-hydroxypropyl)phenyl]benzoic acid |
|---|---|
| PubChem CID | 11525429 |
| Molecular Formula | C30H37NO3 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.28 |
| IUPAC Name | 4-[3-[3-tert-butyl-4-(diethylamino)phenyl]-4-(3-hydroxypropyl)phenyl]benzoic acid |
| SMILES | CCN(CC)c1ccc(-c2cc(-c3ccc(C(=O)O)cc3)ccc2CCCO)cc1C(C)(C)C |
| InChI | InChI=1S/C30H37NO3/c1-6-31(7-2)28-17-16-25(20-27(28)30(3,4)5)26-19-24(15-12-22(26)9-8-18-32)21-10-13-23(14-11-21)29(33)34/h10-17,19-20,32H,6-9,18H2,1-5H3,(H,33,34) |
| InChIKey | AGMIORZEZJMCCG-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |