C21H20N4O4 — CID 110585363
3-[4-(dimethylamino)anilino]-4-(4-nitrophenyl)-1-prop-2-enylpyrrole-2,5-dione (PubChem CID 110585363) has the molecular formula C21H20N4O4 and a molecular weight of 392.42 g/mol. Its IUPAC name is 3-[4-(dimethylamino)anilino]-4-(4-nitrophenyl)-1-prop-2-enylpyrrole-2,5-dione.
| Compound Name | 3-[4-(dimethylamino)anilino]-4-(4-nitrophenyl)-1-prop-2-enylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110585363 |
| Molecular Formula | C21H20N4O4 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 3-[4-(dimethylamino)anilino]-4-(4-nitrophenyl)-1-prop-2-enylpyrrole-2,5-dione |
| SMILES | C=CCN1C(=O)C(Nc2ccc(N(C)C)cc2)=C(c2ccc([N+](=O)[O-])cc2)C1=O |
| InChI | InChI=1S/C21H20N4O4/c1-4-13-24-20(26)18(14-5-9-17(10-6-14)25(28)29)19(21(24)27)22-15-7-11-16(12-8-15)23(2)3/h4-12,22H,1,13H2,2-3H3 |
| InChIKey | YOHIWMFLXMWRBI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|