C34H44N2O10 — CID 102337637
1,4-bis[4-(hydroxymethyl)phenyl]-2,5-bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl]pyrrolo[3,4-c]pyrrole-3,6-dione (PubChem CID 102337637) has the molecular formula C34H44N2O10 and a molecular weight of 640.73 g/mol. Its IUPAC name is 1,4-bis[4-(hydroxymethyl)phenyl]-2,5-bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl]pyrrolo[3,4-c]pyrrole-3,6-dione.
| Compound Name | 1,4-bis[4-(hydroxymethyl)phenyl]-2,5-bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl]pyrrolo[3,4-c]pyrrole-3,6-dione |
|---|---|
| PubChem CID | 102337637 |
| Molecular Formula | C34H44N2O10 |
| Molecular Weight | 640.73 g/mol |
| Exact Mass | 640.30 |
| IUPAC Name | 1,4-bis[4-(hydroxymethyl)phenyl]-2,5-bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl]pyrrolo[3,4-c]pyrrole-3,6-dione |
| SMILES | COCCOCCOCCN1C(=O)C2=C(c3ccc(CO)cc3)N(CCOCCOCCOC)C(=O)C2=C1c1ccc(CO)cc1 |
| InChI | InChI=1S/C34H44N2O10/c1-41-15-17-45-21-19-43-13-11-35-31(27-7-3-25(23-37)4-8-27)29-30(33(35)39)32(28-9-5-26(24-38)6-10-28)36(34(29)40)12-14-44-20-22-46-18-16-42-2/h3-10,37-38H,11-24H2,1-2H3 |
| InChIKey | DNOGYAKNJQADTJ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 136.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.73 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|