C32H40N2O8 — CID 11093076
2,5-bis[2-(2-ethoxyethoxy)ethyl]-1,4-bis(4-methoxyphenyl)pyrrolo[3,4-c]pyrrole-3,6-dione (PubChem CID 11093076) has the molecular formula C32H40N2O8 and a molecular weight of 580.68 g/mol. Its IUPAC name is 2,5-bis[2-(2-ethoxyethoxy)ethyl]-1,4-bis(4-methoxyphenyl)pyrrolo[3,4-c]pyrrole-3,6-dione.
| Compound Name | 2,5-bis[2-(2-ethoxyethoxy)ethyl]-1,4-bis(4-methoxyphenyl)pyrrolo[3,4-c]pyrrole-3,6-dione |
|---|---|
| PubChem CID | 11093076 |
| Molecular Formula | C32H40N2O8 |
| Molecular Weight | 580.68 g/mol |
| Exact Mass | 580.28 |
| IUPAC Name | 2,5-bis[2-(2-ethoxyethoxy)ethyl]-1,4-bis(4-methoxyphenyl)pyrrolo[3,4-c]pyrrole-3,6-dione |
| SMILES | CCOCCOCCN1C(=O)C2=C(c3ccc(OC)cc3)N(CCOCCOCC)C(=O)C2=C1c1ccc(OC)cc1 |
| InChI | InChI=1S/C32H40N2O8/c1-5-39-19-21-41-17-15-33-29(23-7-11-25(37-3)12-8-23)27-28(31(33)35)30(24-9-13-26(38-4)14-10-24)34(32(27)36)16-18-42-22-20-40-6-2/h7-14H,5-6,15-22H2,1-4H3 |
| InChIKey | URFHFNSYELNEEH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 96.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.68 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|