C20H27N3O2 — CID 100989983
3-(diethylamino)-6-[4-(diethylamino)-2-hydroxyphenyl]iminocyclohexa-2,4-dien-1-one (PubChem CID 100989983) has the molecular formula C20H27N3O2 and a molecular weight of 341.46 g/mol. Its IUPAC name is 3-(diethylamino)-6-[4-(diethylamino)-2-hydroxyphenyl]iminocyclohexa-2,4-dien-1-one.
| Compound Name | 3-(diethylamino)-6-[4-(diethylamino)-2-hydroxyphenyl]iminocyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 100989983 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 3-(diethylamino)-6-[4-(diethylamino)-2-hydroxyphenyl]iminocyclohexa-2,4-dien-1-one |
| SMILES | CCN(CC)C1=CC(=O)/C(=N\c2ccc(N(CC)CC)cc2O)C=C1 |
| InChI | InChI=1S/C20H27N3O2/c1-5-22(6-2)15-9-11-17(19(24)13-15)21-18-12-10-16(14-20(18)25)23(7-3)8-4/h9-14,24H,5-8H2,1-4H3/b21-18- |
| InChIKey | XJIQXVWSCLNZGE-UZYVYHOESA-N |
| XLogP | 3.68 |
| TPSA | 56.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|