C50H52N4O4 — CID 15265890
11,23-bis[[4-(diethylamino)-2-methylphenyl]imino]-26,28-dihydroxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,12,15,17,19(26),21-decaene-25,27-dione (PubChem CID 15265890) has the molecular formula C50H52N4O4 and a molecular weight of 772.99 g/mol. Its IUPAC name is 11,23-bis[[4-(diethylamino)-2-methylphenyl]imino]-26,28-dihydroxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,12,15,17,19(26),21-decaene-25,27-dione.
| Compound Name | 11,23-bis[[4-(diethylamino)-2-methylphenyl]imino]-26,28-dihydroxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,12,15,17,19(26),21-decaene-25,27-dione |
|---|---|
| PubChem CID | 15265890 |
| Molecular Formula | C50H52N4O4 |
| Molecular Weight | 772.99 g/mol |
| Exact Mass | 772.40 |
| IUPAC Name | 11,23-bis[[4-(diethylamino)-2-methylphenyl]imino]-26,28-dihydroxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,12,15,17,19(26),21-decaene-25,27-dione |
| SMILES | CCN(CC)c1ccc(N=C2C=C3Cc4cccc(c4O)CC4=CC(=Nc5ccc(N(CC)CC)cc5C)C=C(Cc5cccc(c5O)CC(=C2)C3=O)C4=O)c(C)c1 |
| InChI | InChI=1S/C50H52N4O4/c1-7-53(8-2)43-17-19-45(31(5)21-43)51-41-27-37-23-33-13-11-15-35(47(33)55)25-39-29-42(52-46-20-18-44(22-32(46)6)54(9-3)10-4)30-40(50(39)58)26-36-16-12-14-34(48(36)56)24-38(28-41)49(37)57/h11-22,27-30,55-56H,7-10,23-26H2,1-6H3/b51-41-,52-42+ |
| InChIKey | ULAAROADKAZCPK-UVJBCRCQSA-N |
| XLogP | 9.71 |
| TPSA | 105.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.99 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|