C19H24ClN3O — CID 144909441
6-amino-2-chloro-4-[4-(diethylamino)-2-methylphenyl]imino-3-ethylcyclohexa-2,5-dien-1-one (PubChem CID 144909441) has the molecular formula C19H24ClN3O and a molecular weight of 345.87 g/mol. Its IUPAC name is 6-amino-2-chloro-4-[4-(diethylamino)-2-methylphenyl]imino-3-ethylcyclohexa-2,5-dien-1-one.
| Compound Name | 6-amino-2-chloro-4-[4-(diethylamino)-2-methylphenyl]imino-3-ethylcyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 144909441 |
| Molecular Formula | C19H24ClN3O |
| Molecular Weight | 345.87 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 6-amino-2-chloro-4-[4-(diethylamino)-2-methylphenyl]imino-3-ethylcyclohexa-2,5-dien-1-one |
| SMILES | CCC1=C(Cl)C(=O)C(N)=C/C1=N\c1ccc(N(CC)CC)cc1C |
| InChI | InChI=1S/C19H24ClN3O/c1-5-14-17(11-15(21)19(24)18(14)20)22-16-9-8-13(10-12(16)4)23(6-2)7-3/h8-11H,5-7,21H2,1-4H3/b22-17+ |
| InChIKey | KSACVXFYBMQDJR-OQKWZONESA-N |
| XLogP | 4.24 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.87 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|