C27H28ClN3O4 — CID 135971933
N-[5-chloro-3-[4-(diethylamino)-2-methylphenyl]imino-4-methyl-6-oxocyclohexa-1,4-dien-1-yl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide (PubChem CID 135971933) has the molecular formula C27H28ClN3O4 and a molecular weight of 493.99 g/mol. Its IUPAC name is N-[5-chloro-3-[4-(diethylamino)-2-methylphenyl]imino-4-methyl-6-oxocyclohexa-1,4-dien-1-yl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide.
| Compound Name | N-[5-chloro-3-[4-(diethylamino)-2-methylphenyl]imino-4-methyl-6-oxocyclohexa-1,4-dien-1-yl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
|---|---|
| PubChem CID | 135971933 |
| Molecular Formula | C27H28ClN3O4 |
| Molecular Weight | 493.99 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | N-[5-chloro-3-[4-(diethylamino)-2-methylphenyl]imino-4-methyl-6-oxocyclohexa-1,4-dien-1-yl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
| SMILES | CCN(CC)c1ccc(/N=C2/C=C(NC(=O)c3ccc4c(c3)OCCO4)C(=O)C(Cl)=C2C)c(C)c1 |
| InChI | InChI=1S/C27H28ClN3O4/c1-5-31(6-2)19-8-9-20(16(3)13-19)29-21-15-22(26(32)25(28)17(21)4)30-27(33)18-7-10-23-24(14-18)35-12-11-34-23/h7-10,13-15H,5-6,11-12H2,1-4H3,(H,30,33)/b29-21- |
| InChIKey | AHGBHGGQVPKWOT-ANYBSYGZSA-N |
| XLogP | 5.09 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.99 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|