C17H19F2N3O2 — CID 4164065
2-[4-[(2,5-difluorophenyl)diazenyl]-N-(2-hydroxyethyl)-3-methylanilino]ethanol (PubChem CID 4164065) has the molecular formula C17H19F2N3O2 and a molecular weight of 335.35 g/mol. Its IUPAC name is 2-[4-[(2,5-difluorophenyl)diazenyl]-N-(2-hydroxyethyl)-3-methylanilino]ethanol.
| Compound Name | 2-[4-[(2,5-difluorophenyl)diazenyl]-N-(2-hydroxyethyl)-3-methylanilino]ethanol |
|---|---|
| PubChem CID | 4164065 |
| Molecular Formula | C17H19F2N3O2 |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 2-[4-[(2,5-difluorophenyl)diazenyl]-N-(2-hydroxyethyl)-3-methylanilino]ethanol |
| SMILES | Cc1cc(N(CCO)CCO)ccc1/N=N/c1cc(F)ccc1F |
| InChI | InChI=1S/C17H19F2N3O2/c1-12-10-14(22(6-8-23)7-9-24)3-5-16(12)20-21-17-11-13(18)2-4-15(17)19/h2-5,10-11,23-24H,6-9H2,1H3/b21-20+ |
| InChIKey | GXZTYQUEABMZSU-QZQOTICOSA-N |
| XLogP | 3.48 |
| TPSA | 68.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|