C18H25N4O4S+ — CID 147368006
2-[[4-[bis(2-methoxyethyl)amino]-2-methylphenyl]diazenyl]-3-methyl-1,3-thiazol-3-ium-4-carboxylic acid (PubChem CID 147368006) has the molecular formula C18H25N4O4S+ and a molecular weight of 393.49 g/mol. Its IUPAC name is 2-[[4-[bis(2-methoxyethyl)amino]-2-methylphenyl]diazenyl]-3-methyl-1,3-thiazol-3-ium-4-carboxylic acid.
| Compound Name | 2-[[4-[bis(2-methoxyethyl)amino]-2-methylphenyl]diazenyl]-3-methyl-1,3-thiazol-3-ium-4-carboxylic acid |
|---|---|
| PubChem CID | 147368006 |
| Molecular Formula | C18H25N4O4S+ |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 2-[[4-[bis(2-methoxyethyl)amino]-2-methylphenyl]diazenyl]-3-methyl-1,3-thiazol-3-ium-4-carboxylic acid |
| SMILES | COCCN(CCOC)c1ccc(/N=N/c2scc(C(=O)O)[n+]2C)c(C)c1 |
| InChI | InChI=1S/C18H24N4O4S/c1-13-11-14(22(7-9-25-3)8-10-26-4)5-6-15(13)19-20-18-21(2)16(12-27-18)17(23)24/h5-6,11-12H,7-10H2,1-4H3/p+1 |
| InChIKey | DINXWUPROVTMBE-UHFFFAOYSA-O |
| XLogP | 3.09 |
| TPSA | 87.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|