C19H17Cl2N5S — CID 165341189
3-[4-[(5,7-dichloro-1,3-benzothiazol-2-yl)diazenyl]-N-ethyl-3-methylanilino]propanenitrile (PubChem CID 165341189) has the molecular formula C19H17Cl2N5S and a molecular weight of 418.35 g/mol. Its IUPAC name is 3-[4-[(5,7-dichloro-1,3-benzothiazol-2-yl)diazenyl]-N-ethyl-3-methylanilino]propanenitrile.
| Compound Name | 3-[4-[(5,7-dichloro-1,3-benzothiazol-2-yl)diazenyl]-N-ethyl-3-methylanilino]propanenitrile |
|---|---|
| PubChem CID | 165341189 |
| Molecular Formula | C19H17Cl2N5S |
| Molecular Weight | 418.35 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | 3-[4-[(5,7-dichloro-1,3-benzothiazol-2-yl)diazenyl]-N-ethyl-3-methylanilino]propanenitrile |
| SMILES | CCN(CCC#N)c1ccc(/N=N/c2nc3cc(Cl)cc(Cl)c3s2)c(C)c1 |
| InChI | InChI=1S/C19H17Cl2N5S/c1-3-26(8-4-7-22)14-5-6-16(12(2)9-14)24-25-19-23-17-11-13(20)10-15(21)18(17)27-19/h5-6,9-11H,3-4,8H2,1-2H3/b25-24+ |
| InChIKey | JJBGSHRLFYEAIM-OCOZRVBESA-N |
| XLogP | 7.07 |
| TPSA | 64.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.35 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|