C29H34N4O — CID 86294802
3-[4-[(1E,4E)-5-[4-[2-cyanoethyl(ethyl)amino]-2-methylphenyl]-3-oxopenta-1,4-dienyl]-N-ethyl-3-methylanilino]propanenitrile (PubChem CID 86294802) has the molecular formula C29H34N4O and a molecular weight of 454.62 g/mol. Its IUPAC name is 3-[4-[(1E,4E)-5-[4-[2-cyanoethyl(ethyl)amino]-2-methylphenyl]-3-oxopenta-1,4-dienyl]-N-ethyl-3-methylanilino]propanenitrile.
| Compound Name | 3-[4-[(1E,4E)-5-[4-[2-cyanoethyl(ethyl)amino]-2-methylphenyl]-3-oxopenta-1,4-dienyl]-N-ethyl-3-methylanilino]propanenitrile |
|---|---|
| PubChem CID | 86294802 |
| Molecular Formula | C29H34N4O |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | 3-[4-[(1E,4E)-5-[4-[2-cyanoethyl(ethyl)amino]-2-methylphenyl]-3-oxopenta-1,4-dienyl]-N-ethyl-3-methylanilino]propanenitrile |
| SMILES | CCN(CCC#N)c1ccc(/C=C/C(=O)/C=C/c2ccc(N(CC)CCC#N)cc2C)c(C)c1 |
| InChI | InChI=1S/C29H34N4O/c1-5-32(19-7-17-30)27-13-9-25(23(3)21-27)11-15-29(34)16-12-26-10-14-28(22-24(26)4)33(6-2)20-8-18-31/h9-16,21-22H,5-8,19-20H2,1-4H3/b15-11+,16-12+ |
| InChIKey | PXWNALAYSDFWSE-JOBJLJCHSA-N |
| XLogP | 6.08 |
| TPSA | 71.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|