C15H18N6 — CID 9014516
3-[N-ethyl-3-methyl-4-[(Z)-1,2,4-triazol-4-yliminomethyl]anilino]propanenitrile (PubChem CID 9014516) has the molecular formula C15H18N6 and a molecular weight of 282.35 g/mol. Its IUPAC name is 3-[N-ethyl-3-methyl-4-[(Z)-1,2,4-triazol-4-yliminomethyl]anilino]propanenitrile.
| Compound Name | 3-[N-ethyl-3-methyl-4-[(Z)-1,2,4-triazol-4-yliminomethyl]anilino]propanenitrile |
|---|---|
| PubChem CID | 9014516 |
| Molecular Formula | C15H18N6 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 3-[N-ethyl-3-methyl-4-[(Z)-1,2,4-triazol-4-yliminomethyl]anilino]propanenitrile |
| SMILES | CCN(CCC#N)c1ccc(/C=N\n2cnnc2)c(C)c1 |
| InChI | InChI=1S/C15H18N6/c1-3-20(8-4-7-16)15-6-5-14(13(2)9-15)10-19-21-11-17-18-12-21/h5-6,9-12H,3-4,8H2,1-2H3/b19-10- |
| InChIKey | XTJUQYPVGWODLZ-GRSHGNNSSA-N |
| XLogP | 2.21 |
| TPSA | 70.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|