C22H20FN3O2 — CID 9312747
3-[N-ethyl-4-[(Z)-[2-(2-fluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-3-methylanilino]propanenitrile (PubChem CID 9312747) has the molecular formula C22H20FN3O2 and a molecular weight of 377.42 g/mol. Its IUPAC name is 3-[N-ethyl-4-[(Z)-[2-(2-fluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-3-methylanilino]propanenitrile.
| Compound Name | 3-[N-ethyl-4-[(Z)-[2-(2-fluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-3-methylanilino]propanenitrile |
|---|---|
| PubChem CID | 9312747 |
| Molecular Formula | C22H20FN3O2 |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 3-[N-ethyl-4-[(Z)-[2-(2-fluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-3-methylanilino]propanenitrile |
| SMILES | CCN(CCC#N)c1ccc(/C=C2\N=C(c3ccccc3F)OC2=O)c(C)c1 |
| InChI | InChI=1S/C22H20FN3O2/c1-3-26(12-6-11-24)17-10-9-16(15(2)13-17)14-20-22(27)28-21(25-20)18-7-4-5-8-19(18)23/h4-5,7-10,13-14H,3,6,12H2,1-2H3/b20-14- |
| InChIKey | SWHHWRLETYBRAD-ZHZULCJRSA-N |
| XLogP | 4.22 |
| TPSA | 65.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|