C20H22ClN5O — CID 5497840
3-[(4-chlorophenyl)methoxy]-N,N-diethyl-4-[(Z)-1,2,4-triazol-4-yliminomethyl]aniline (PubChem CID 5497840) has the molecular formula C20H22ClN5O and a molecular weight of 383.88 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methoxy]-N,N-diethyl-4-[(Z)-1,2,4-triazol-4-yliminomethyl]aniline.
| Compound Name | 3-[(4-chlorophenyl)methoxy]-N,N-diethyl-4-[(Z)-1,2,4-triazol-4-yliminomethyl]aniline |
|---|---|
| PubChem CID | 5497840 |
| Molecular Formula | C20H22ClN5O |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 3-[(4-chlorophenyl)methoxy]-N,N-diethyl-4-[(Z)-1,2,4-triazol-4-yliminomethyl]aniline |
| SMILES | CCN(CC)c1ccc(/C=N\n2cnnc2)c(OCc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C20H22ClN5O/c1-3-25(4-2)19-10-7-17(12-24-26-14-22-23-15-26)20(11-19)27-13-16-5-8-18(21)9-6-16/h5-12,14-15H,3-4,13H2,1-2H3/b24-12- |
| InChIKey | WKZDOOKPDBOIQL-MSXFZWOLSA-N |
| XLogP | 4.24 |
| TPSA | 55.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|