C25H20Cl2F7N3O — CID 5004764
N-[[2-[(3,4-dichlorophenyl)methoxy]-4-(diethylamino)phenyl]methylideneamino]-2,3,5,6-tetrafluoro-4-(trifluoromethyl)aniline (PubChem CID 5004764) has the molecular formula C25H20Cl2F7N3O and a molecular weight of 582.35 g/mol. Its IUPAC name is N-[[2-[(3,4-dichlorophenyl)methoxy]-4-(diethylamino)phenyl]methylideneamino]-2,3,5,6-tetrafluoro-4-(trifluoromethyl)aniline.
| Compound Name | N-[[2-[(3,4-dichlorophenyl)methoxy]-4-(diethylamino)phenyl]methylideneamino]-2,3,5,6-tetrafluoro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 5004764 |
| Molecular Formula | C25H20Cl2F7N3O |
| Molecular Weight | 582.35 g/mol |
| Exact Mass | 581.09 |
| IUPAC Name | N-[[2-[(3,4-dichlorophenyl)methoxy]-4-(diethylamino)phenyl]methylideneamino]-2,3,5,6-tetrafluoro-4-(trifluoromethyl)aniline |
| SMILES | CCN(CC)c1ccc(C=NNc2c(F)c(F)c(C(F)(F)F)c(F)c2F)c(OCc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C25H20Cl2F7N3O/c1-3-37(4-2)15-7-6-14(18(10-15)38-12-13-5-8-16(26)17(27)9-13)11-35-36-24-22(30)20(28)19(25(32,33)34)21(29)23(24)31/h5-11,36H,3-4,12H2,1-2H3 |
| InChIKey | DVEXKNMSIAAKTL-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.35 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|