C20H10BrCl2F5N2O — CID 6257661
N-[(Z)-[3-bromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2,3,4,5,6-pentafluoroaniline (PubChem CID 6257661) has the molecular formula C20H10BrCl2F5N2O and a molecular weight of 540.11 g/mol. Its IUPAC name is N-[(Z)-[3-bromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2,3,4,5,6-pentafluoroaniline.
| Compound Name | N-[(Z)-[3-bromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2,3,4,5,6-pentafluoroaniline |
|---|---|
| PubChem CID | 6257661 |
| Molecular Formula | C20H10BrCl2F5N2O |
| Molecular Weight | 540.11 g/mol |
| Exact Mass | 537.93 |
| IUPAC Name | N-[(Z)-[3-bromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2,3,4,5,6-pentafluoroaniline |
| SMILES | Fc1c(F)c(F)c(N/N=C\c2ccc(OCc3ccc(Cl)c(Cl)c3)c(Br)c2)c(F)c1F |
| InChI | InChI=1S/C20H10BrCl2F5N2O/c21-11-5-9(2-4-14(11)31-8-10-1-3-12(22)13(23)6-10)7-29-30-20-18(27)16(25)15(24)17(26)19(20)28/h1-7,30H,8H2/b29-7- |
| InChIKey | QMSJRYIQYQLOPO-BPQMRJFZSA-N |
| XLogP | 7.48 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.11 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|