C26H28IN3O2 — CID 126070953
N-[(Z)-[4-(diethylamino)-2-[(4-iodophenyl)methoxy]phenyl]methylideneamino]-2-phenylacetamide (PubChem CID 126070953) has the molecular formula C26H28IN3O2 and a molecular weight of 541.43 g/mol. Its IUPAC name is N-[(Z)-[4-(diethylamino)-2-[(4-iodophenyl)methoxy]phenyl]methylideneamino]-2-phenylacetamide.
| Compound Name | N-[(Z)-[4-(diethylamino)-2-[(4-iodophenyl)methoxy]phenyl]methylideneamino]-2-phenylacetamide |
|---|---|
| PubChem CID | 126070953 |
| Molecular Formula | C26H28IN3O2 |
| Molecular Weight | 541.43 g/mol |
| Exact Mass | 541.12 |
| IUPAC Name | N-[(Z)-[4-(diethylamino)-2-[(4-iodophenyl)methoxy]phenyl]methylideneamino]-2-phenylacetamide |
| SMILES | CCN(CC)c1ccc(/C=N\NC(=O)Cc2ccccc2)c(OCc2ccc(I)cc2)c1 |
| InChI | InChI=1S/C26H28IN3O2/c1-3-30(4-2)24-15-12-22(18-28-29-26(31)16-20-8-6-5-7-9-20)25(17-24)32-19-21-10-13-23(27)14-11-21/h5-15,17-18H,3-4,16,19H2,1-2H3,(H,29,31)/b28-18- |
| InChIKey | PZATYWWOBKKYFQ-VEILYXNESA-N |
| XLogP | 5.41 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.43 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|