C17H22N6S — CID 9256822
3-[N-ethyl-4-[(Z)-(3-ethyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]-3-methylanilino]propanenitrile (PubChem CID 9256822) has the molecular formula C17H22N6S and a molecular weight of 342.47 g/mol. Its IUPAC name is 3-[N-ethyl-4-[(Z)-(3-ethyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]-3-methylanilino]propanenitrile.
| Compound Name | 3-[N-ethyl-4-[(Z)-(3-ethyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]-3-methylanilino]propanenitrile |
|---|---|
| PubChem CID | 9256822 |
| Molecular Formula | C17H22N6S |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 3-[N-ethyl-4-[(Z)-(3-ethyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]-3-methylanilino]propanenitrile |
| SMILES | CCc1n[nH]c(=S)n1/N=C\c1ccc(N(CC)CCC#N)cc1C |
| InChI | InChI=1S/C17H22N6S/c1-4-16-20-21-17(24)23(16)19-12-14-7-8-15(11-13(14)3)22(5-2)10-6-9-18/h7-8,11-12H,4-6,10H2,1-3H3,(H,21,24)/b19-12- |
| InChIKey | RWSNZIIFSVIDCP-UNOMPAQXSA-N |
| XLogP | 3.43 |
| TPSA | 73.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|