C20H22FN5OS — CID 9038975
4-[(Z)-[4-[ethyl(2-hydroxyethyl)amino]-2-methylphenyl]methylideneamino]-3-(3-fluorophenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 9038975) has the molecular formula C20H22FN5OS and a molecular weight of 399.50 g/mol. Its IUPAC name is 4-[(Z)-[4-[ethyl(2-hydroxyethyl)amino]-2-methylphenyl]methylideneamino]-3-(3-fluorophenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-[4-[ethyl(2-hydroxyethyl)amino]-2-methylphenyl]methylideneamino]-3-(3-fluorophenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 9038975 |
| Molecular Formula | C20H22FN5OS |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 4-[(Z)-[4-[ethyl(2-hydroxyethyl)amino]-2-methylphenyl]methylideneamino]-3-(3-fluorophenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | CCN(CCO)c1ccc(/C=N\n2c(-c3cccc(F)c3)n[nH]c2=S)c(C)c1 |
| InChI | InChI=1S/C20H22FN5OS/c1-3-25(9-10-27)18-8-7-16(14(2)11-18)13-22-26-19(23-24-20(26)28)15-5-4-6-17(21)12-15/h4-8,11-13,27H,3,9-10H2,1-2H3,(H,24,28)/b22-13- |
| InChIKey | OUBSRFJONAMECL-XKZIYDEJSA-N |
| XLogP | 3.76 |
| TPSA | 69.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|