C18H26N4O2 — CID 9074926
tert-butyl N-[(Z)-[4-[2-cyanoethyl(ethyl)amino]-2-methylphenyl]methylideneamino]carbamate (PubChem CID 9074926) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is tert-butyl N-[(Z)-[4-[2-cyanoethyl(ethyl)amino]-2-methylphenyl]methylideneamino]carbamate.
| Compound Name | tert-butyl N-[(Z)-[4-[2-cyanoethyl(ethyl)amino]-2-methylphenyl]methylideneamino]carbamate |
|---|---|
| PubChem CID | 9074926 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | tert-butyl N-[(Z)-[4-[2-cyanoethyl(ethyl)amino]-2-methylphenyl]methylideneamino]carbamate |
| SMILES | CCN(CCC#N)c1ccc(/C=N\NC(=O)OC(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C18H26N4O2/c1-6-22(11-7-10-19)16-9-8-15(14(2)12-16)13-20-21-17(23)24-18(3,4)5/h8-9,12-13H,6-7,11H2,1-5H3,(H,21,23)/b20-13- |
| InChIKey | IJALUHUQUPEYBS-MOSHPQCFSA-N |
| XLogP | 3.59 |
| TPSA | 77.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|