C14H13N3O2 — CID 55039098
(E)-3-[4-[bis(cyanomethyl)amino]-2-methylphenyl]prop-2-enoic acid (PubChem CID 55039098) has the molecular formula C14H13N3O2 and a molecular weight of 255.28 g/mol. Its IUPAC name is (E)-3-[4-[bis(cyanomethyl)amino]-2-methylphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[bis(cyanomethyl)amino]-2-methylphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 55039098 |
| Molecular Formula | C14H13N3O2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | (E)-3-[4-[bis(cyanomethyl)amino]-2-methylphenyl]prop-2-enoic acid |
| SMILES | Cc1cc(N(CC#N)CC#N)ccc1/C=C/C(=O)O |
| InChI | InChI=1S/C14H13N3O2/c1-11-10-13(17(8-6-15)9-7-16)4-2-12(11)3-5-14(18)19/h2-5,10H,8-9H2,1H3,(H,18,19)/b5-3+ |
| InChIKey | ICZLIUQTYJIXQN-HWKANZROSA-N |
| XLogP | 1.95 |
| TPSA | 88.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|