C13H10BrN3O2 — CID 43364791
(E)-3-[2-[bis(cyanomethyl)amino]-4-bromophenyl]prop-2-enoic acid (PubChem CID 43364791) has the molecular formula C13H10BrN3O2 and a molecular weight of 320.15 g/mol. Its IUPAC name is (E)-3-[2-[bis(cyanomethyl)amino]-4-bromophenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-[bis(cyanomethyl)amino]-4-bromophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 43364791 |
| Molecular Formula | C13H10BrN3O2 |
| Molecular Weight | 320.15 g/mol |
| Exact Mass | 319.00 |
| IUPAC Name | (E)-3-[2-[bis(cyanomethyl)amino]-4-bromophenyl]prop-2-enoic acid |
| SMILES | N#CCN(CC#N)c1cc(Br)ccc1/C=C/C(=O)O |
| InChI | InChI=1S/C13H10BrN3O2/c14-11-3-1-10(2-4-13(18)19)12(9-11)17(7-5-15)8-6-16/h1-4,9H,7-8H2,(H,18,19)/b4-2+ |
| InChIKey | JKOKXHIDNNZMAW-DUXPYHPUSA-N |
| XLogP | 2.40 |
| TPSA | 88.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.15 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|