C15H18BrNO2 — CID 62859731
(E)-3-[4-bromo-2-[cyclobutylmethyl(methyl)amino]phenyl]prop-2-enoic acid (PubChem CID 62859731) has the molecular formula C15H18BrNO2 and a molecular weight of 324.22 g/mol. Its IUPAC name is (E)-3-[4-bromo-2-[cyclobutylmethyl(methyl)amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-bromo-2-[cyclobutylmethyl(methyl)amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 62859731 |
| Molecular Formula | C15H18BrNO2 |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | (E)-3-[4-bromo-2-[cyclobutylmethyl(methyl)amino]phenyl]prop-2-enoic acid |
| SMILES | CN(CC1CCC1)c1cc(Br)ccc1/C=C/C(=O)O |
| InChI | InChI=1S/C15H18BrNO2/c1-17(10-11-3-2-4-11)14-9-13(16)7-5-12(14)6-8-15(18)19/h5-9,11H,2-4,10H2,1H3,(H,18,19)/b8-6+ |
| InChIKey | RXVJFSQVCXCAJE-SOFGYWHQSA-N |
| XLogP | 3.78 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|