C13H14BrN3O4 — CID 76977943
3-[2-[bis(2-amino-2-oxoethyl)amino]-4-bromophenyl]prop-2-enoic acid (PubChem CID 76977943) has the molecular formula C13H14BrN3O4 and a molecular weight of 356.18 g/mol. Its IUPAC name is 3-[2-[bis(2-amino-2-oxoethyl)amino]-4-bromophenyl]prop-2-enoic acid.
| Compound Name | 3-[2-[bis(2-amino-2-oxoethyl)amino]-4-bromophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76977943 |
| Molecular Formula | C13H14BrN3O4 |
| Molecular Weight | 356.18 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | 3-[2-[bis(2-amino-2-oxoethyl)amino]-4-bromophenyl]prop-2-enoic acid |
| SMILES | NC(=O)CN(CC(N)=O)c1cc(Br)ccc1C=CC(=O)O |
| InChI | InChI=1S/C13H14BrN3O4/c14-9-3-1-8(2-4-13(20)21)10(5-9)17(6-11(15)18)7-12(16)19/h1-5H,6-7H2,(H2,15,18)(H2,16,19)(H,20,21) |
| InChIKey | UIUHBQRYGBPCPN-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 126.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.18 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|