C19H24ClN6S+ — CID 87432930
3-chloro-4-[(4,5-dimethyl-1,3-thiazol-2-yl)diazenyl]-N-ethyl-N-[2-(3-methylimidazol-3-ium-1-yl)ethyl]aniline (PubChem CID 87432930) has the molecular formula C19H24ClN6S+ and a molecular weight of 403.96 g/mol. Its IUPAC name is 3-chloro-4-[(4,5-dimethyl-1,3-thiazol-2-yl)diazenyl]-N-ethyl-N-[2-(3-methylimidazol-3-ium-1-yl)ethyl]aniline.
| Compound Name | 3-chloro-4-[(4,5-dimethyl-1,3-thiazol-2-yl)diazenyl]-N-ethyl-N-[2-(3-methylimidazol-3-ium-1-yl)ethyl]aniline |
|---|---|
| PubChem CID | 87432930 |
| Molecular Formula | C19H24ClN6S+ |
| Molecular Weight | 403.96 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 3-chloro-4-[(4,5-dimethyl-1,3-thiazol-2-yl)diazenyl]-N-ethyl-N-[2-(3-methylimidazol-3-ium-1-yl)ethyl]aniline |
| SMILES | CCN(CCn1cc[n+](C)c1)c1ccc(/N=N/c2nc(C)c(C)s2)c(Cl)c1 |
| InChI | InChI=1S/C19H24ClN6S/c1-5-26(11-10-25-9-8-24(4)13-25)16-6-7-18(17(20)12-16)22-23-19-21-14(2)15(3)27-19/h6-9,12-13H,5,10-11H2,1-4H3/q+1/b23-22+ |
| InChIKey | WXXQTFMBZNIKCH-GHVJWSGMSA-N |
| XLogP | 4.98 |
| TPSA | 49.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.96 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|