C23H32N5O2+ — CID 87626568
4-[4-[ethyl-[2-(3-methylimidazol-3-ium-1-yl)ethyl]amino]anilino]-5-(2-hydroxyethylamino)-2-methylphenol (PubChem CID 87626568) has the molecular formula C23H32N5O2+ and a molecular weight of 410.54 g/mol. Its IUPAC name is 4-[4-[ethyl-[2-(3-methylimidazol-3-ium-1-yl)ethyl]amino]anilino]-5-(2-hydroxyethylamino)-2-methylphenol.
| Compound Name | 4-[4-[ethyl-[2-(3-methylimidazol-3-ium-1-yl)ethyl]amino]anilino]-5-(2-hydroxyethylamino)-2-methylphenol |
|---|---|
| PubChem CID | 87626568 |
| Molecular Formula | C23H32N5O2+ |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | 4-[4-[ethyl-[2-(3-methylimidazol-3-ium-1-yl)ethyl]amino]anilino]-5-(2-hydroxyethylamino)-2-methylphenol |
| SMILES | CCN(CCn1cc[n+](C)c1)c1ccc(Nc2cc(C)c(O)cc2NCCO)cc1 |
| InChI | InChI=1S/C23H31N5O2/c1-4-28(13-12-27-11-10-26(3)17-27)20-7-5-19(6-8-20)25-22-15-18(2)23(30)16-21(22)24-9-14-29/h5-8,10-11,15-17,24-25,29H,4,9,12-14H2,1-3H3/p+1 |
| InChIKey | XAINMBFIXZBAQZ-UHFFFAOYSA-O |
| XLogP | 3.00 |
| TPSA | 76.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|